C11H8N4O5 — CID 2148521
N-(2,4-dioxo-1H-pyrimidin-6-yl)-3-nitrobenzamide (PubChem CID 2148521) has the molecular formula C11H8N4O5 and a molecular weight of 276.21 g/mol. Its IUPAC name is N-(2,4-dioxo-1H-pyrimidin-6-yl)-3-nitrobenzamide.
| Compound Name | N-(2,4-dioxo-1H-pyrimidin-6-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 2148521 |
| Molecular Formula | C11H8N4O5 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | N-(2,4-dioxo-1H-pyrimidin-6-yl)-3-nitrobenzamide |
| SMILES | O=C(Nc1cc(=O)[nH]c(=O)[nH]1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H8N4O5/c16-9-5-8(13-11(18)14-9)12-10(17)6-2-1-3-7(4-6)15(19)20/h1-5H,(H3,12,13,14,16,17,18) |
| InChIKey | POBLJFCKEOOMBO-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 137.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|