About 3-bromo-2-methylbutanoic acid
3-bromo-2-methylbutanoic acid (PubChem CID 21485397) has the molecular formula C5H9BrO2
and a molecular weight of 181.03 g/mol. Its IUPAC name is 3-bromo-2-methylbutanoic acid.
Molecular Properties
| Compound Name | 3-bromo-2-methylbutanoic acid |
| PubChem CID | 21485397 |
| Molecular Formula | C5H9BrO2 |
| Molecular Weight | 181.03 g/mol |
| Exact Mass | 179.98 |
| IUPAC Name | 3-bromo-2-methylbutanoic acid |
| SMILES | CC(Br)C(C)C(=O)O |
| InChI | InChI=1S/C5H9BrO2/c1-3(4(2)6)5(7)8/h3-4H,1-2H3,(H,7,8) |
| InChIKey | VUZHINQEMOOOQI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.03 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2-methylbutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-methylbutanoic acid?
The IUPAC name of 3-bromo-2-methylbutanoic acid (CID 21485397) is 3-bromo-2-methylbutanoic acid.
What is the SMILES notation for 3-bromo-2-methylbutanoic acid?
The canonical SMILES for 3-bromo-2-methylbutanoic acid is CC(Br)C(C)C(=O)O.
What is the InChIKey of 3-bromo-2-methylbutanoic acid?
The InChIKey is VUZHINQEMOOOQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9BrO2/c1-3(4(2)6)5(7)8/h3-4H,1-2H3,(H,7,8).
What are the key properties of 3-bromo-2-methylbutanoic acid?
3-bromo-2-methylbutanoic acid has a molecular weight of 181.03 g/mol, XLogP of 1.49, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-methylbutanoic acid is sourced from PubChem (CID 21485397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).