About bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one
bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one (PubChem CID 21485623) has the molecular formula C16H25NO2
and a molecular weight of 263.38 g/mol. Its IUPAC name is bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one.
Molecular Properties
| Compound Name | bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one |
| PubChem CID | 21485623 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one |
| SMILES | CCCC(=O)CCN(CC)CC.Oc1ccc2cc1-2 |
| InChI | InChI=1S/C10H21NO.C6H4O/c1-4-7-10(12)8-9-11(5-2)6-3;7-6-2-1-4-3-5(4)6/h4-9H2,1-3H3;1-3,7H |
| InChIKey | PTKLYPBTUDNYLW-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one?
The IUPAC name of bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one (CID 21485623) is bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one.
What is the SMILES notation for bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one?
The canonical SMILES for bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one is CCCC(=O)CCN(CC)CC.Oc1ccc2cc1-2.
What is the InChIKey of bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one?
The InChIKey is PTKLYPBTUDNYLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO.C6H4O/c1-4-7-10(12)8-9-11(5-2)6-3;7-6-2-1-4-3-5(4)6/h4-9H2,1-3H3;1-3,7H.
What are the key properties of bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one?
bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one has a molecular weight of 263.38 g/mol, XLogP of 3.46, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[3.1.0]hexa-1,3,5-trien-2-ol;1-(diethylamino)hexan-3-one is sourced from PubChem (CID 21485623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).