C15H20O — CID 21485718
hex-1-yne;3-propoxybicyclo[3.1.0]hexa-1(6),2,4-triene (PubChem CID 21485718) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is hex-1-yne;3-propoxybicyclo[3.1.0]hexa-1(6),2,4-triene.
| Compound Name | hex-1-yne;3-propoxybicyclo[3.1.0]hexa-1(6),2,4-triene |
|---|---|
| PubChem CID | 21485718 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | hex-1-yne;3-propoxybicyclo[3.1.0]hexa-1(6),2,4-triene |
| SMILES | C#CCCCC.CCCOc1cc2cc-2c1 |
| InChI | InChI=1S/C9H10O.C6H10/c1-2-3-10-9-5-7-4-8(7)6-9;1-3-5-6-4-2/h4-6H,2-3H2,1H3;1H,4-6H2,2H3 |
| InChIKey | RRVRQCQVDFXCKL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|