C9H16ClN5O2 — CID 21485891
ethyl N-[[6-(dimethylamino)pyridazin-3-yl]amino]carbamate;hydrochloride (PubChem CID 21485891) has the molecular formula C9H16ClN5O2 and a molecular weight of 261.71 g/mol. Its IUPAC name is ethyl N-[[6-(dimethylamino)pyridazin-3-yl]amino]carbamate;hydrochloride.
| Compound Name | ethyl N-[[6-(dimethylamino)pyridazin-3-yl]amino]carbamate;hydrochloride |
|---|---|
| PubChem CID | 21485891 |
| Molecular Formula | C9H16ClN5O2 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | ethyl N-[[6-(dimethylamino)pyridazin-3-yl]amino]carbamate;hydrochloride |
| SMILES | CCOC(=O)NNc1ccc(N(C)C)nn1.Cl |
| InChI | InChI=1S/C9H15N5O2.ClH/c1-4-16-9(15)13-11-7-5-6-8(12-10-7)14(2)3;/h5-6H,4H2,1-3H3,(H,10,11)(H,13,15);1H |
| InChIKey | HTVSZASGJPWTHC-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|