C17H17N5O5S2 — CID 21485978
methyl N-[[2-(methoxycarbonylcarbamothioylamino)-5-phenoxy-3-pyridinyl]carbamothioyl]carbamate (PubChem CID 21485978) has the molecular formula C17H17N5O5S2 and a molecular weight of 435.49 g/mol. Its IUPAC name is methyl N-[[2-(methoxycarbonylcarbamothioylamino)-5-phenoxy-3-pyridinyl]carbamothioyl]carbamate.
| Compound Name | methyl N-[[2-(methoxycarbonylcarbamothioylamino)-5-phenoxy-3-pyridinyl]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 21485978 |
| Molecular Formula | C17H17N5O5S2 |
| Molecular Weight | 435.49 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | methyl N-[[2-(methoxycarbonylcarbamothioylamino)-5-phenoxy-3-pyridinyl]carbamothioyl]carbamate |
| SMILES | COC(=O)NC(=S)Nc1cc(Oc2ccccc2)cnc1NC(=S)NC(=O)OC |
| InChI | InChI=1S/C17H17N5O5S2/c1-25-16(23)21-14(28)19-12-8-11(27-10-6-4-3-5-7-10)9-18-13(12)20-15(29)22-17(24)26-2/h3-9H,1-2H3,(H2,19,21,23,28)(H2,18,20,22,24,29) |
| InChIKey | IDJGNWYFNSXPSZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 122.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.49 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|