C9H10F6 — CID 21486071
3-(1,1,2,3,3,3-hexafluoropropyl)cyclohexene (PubChem CID 21486071) has the molecular formula C9H10F6 and a molecular weight of 232.17 g/mol. Its IUPAC name is 3-(1,1,2,3,3,3-hexafluoropropyl)cyclohexene.
| Compound Name | 3-(1,1,2,3,3,3-hexafluoropropyl)cyclohexene |
|---|---|
| PubChem CID | 21486071 |
| Molecular Formula | C9H10F6 |
| Molecular Weight | 232.17 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-(1,1,2,3,3,3-hexafluoropropyl)cyclohexene |
| SMILES | FC(C(F)(F)F)C(F)(F)C1C=CCCC1 |
| InChI | InChI=1S/C9H10F6/c10-7(9(13,14)15)8(11,12)6-4-2-1-3-5-6/h2,4,6-7H,1,3,5H2 |
| InChIKey | SYXOINGYRSIWTE-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.17 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|