About 5-chloro-1,3-benzothiazol-4-amine
5-chloro-1,3-benzothiazol-4-amine (PubChem CID 21486281) has the molecular formula C7H5ClN2S
and a molecular weight of 184.65 g/mol. Its IUPAC name is 5-chloro-1,3-benzothiazol-4-amine.
Molecular Properties
| Compound Name | 5-chloro-1,3-benzothiazol-4-amine |
| PubChem CID | 21486281 |
| Molecular Formula | C7H5ClN2S |
| Molecular Weight | 184.65 g/mol |
| Exact Mass | 183.99 |
| IUPAC Name | 5-chloro-1,3-benzothiazol-4-amine |
| SMILES | Nc1c(Cl)ccc2scnc12 |
| InChI | InChI=1S/C7H5ClN2S/c8-4-1-2-5-7(6(4)9)10-3-11-5/h1-3H,9H2 |
| InChIKey | MYLQPGDEVXPATO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-1,3-benzothiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,3-benzothiazol-4-amine?
The IUPAC name of 5-chloro-1,3-benzothiazol-4-amine (CID 21486281) is 5-chloro-1,3-benzothiazol-4-amine.
What is the SMILES notation for 5-chloro-1,3-benzothiazol-4-amine?
The canonical SMILES for 5-chloro-1,3-benzothiazol-4-amine is Nc1c(Cl)ccc2scnc12.
What is the InChIKey of 5-chloro-1,3-benzothiazol-4-amine?
The InChIKey is MYLQPGDEVXPATO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2S/c8-4-1-2-5-7(6(4)9)10-3-11-5/h1-3H,9H2.
What are the key properties of 5-chloro-1,3-benzothiazol-4-amine?
5-chloro-1,3-benzothiazol-4-amine has a molecular weight of 184.65 g/mol, XLogP of 2.53, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-benzothiazol-4-amine is sourced from PubChem (CID 21486281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).