About 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine
3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine (PubChem CID 21486750) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine.
Molecular Properties
| Compound Name | 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine |
| PubChem CID | 21486750 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine |
| SMILES | CCCCC(CC)CN1C=CCNC1C |
| InChI | InChI=1S/C13H26N2/c1-4-6-8-13(5-2)11-15-10-7-9-14-12(15)3/h7,10,12-14H,4-6,8-9,11H2,1-3H3 |
| InChIKey | NXCPHLNOJJIYAV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine?
The IUPAC name of 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine (CID 21486750) is 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine.
What is the SMILES notation for 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine?
The canonical SMILES for 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine is CCCCC(CC)CN1C=CCNC1C.
What is the InChIKey of 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine?
The InChIKey is NXCPHLNOJJIYAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2/c1-4-6-8-13(5-2)11-15-10-7-9-14-12(15)3/h7,10,12-14H,4-6,8-9,11H2,1-3H3.
What are the key properties of 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine?
3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine has a molecular weight of 210.36 g/mol, XLogP of 2.97, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethylhexyl)-2-methyl-2,6-dihydro-1H-pyrimidine is sourced from PubChem (CID 21486750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).