About 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine
3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine (PubChem CID 21486752) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine.
Molecular Properties
| Compound Name | 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine |
| PubChem CID | 21486752 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine |
| SMILES | CCCCN1C=CCNC1C |
| InChI | InChI=1S/C9H18N2/c1-3-4-7-11-8-5-6-10-9(11)2/h5,8-10H,3-4,6-7H2,1-2H3 |
| InChIKey | ZPOKGRVLCZSAHU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine?
The IUPAC name of 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine (CID 21486752) is 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine.
What is the SMILES notation for 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine?
The canonical SMILES for 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine is CCCCN1C=CCNC1C.
What is the InChIKey of 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine?
The InChIKey is ZPOKGRVLCZSAHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-3-4-7-11-8-5-6-10-9(11)2/h5,8-10H,3-4,6-7H2,1-2H3.
What are the key properties of 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine?
3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine has a molecular weight of 154.26 g/mol, XLogP of 1.55, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-2-methyl-2,6-dihydro-1H-pyrimidine is sourced from PubChem (CID 21486752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).