C12H13N3 — CID 21486764
2,8,11,12-tetrahydropyrimido[2,1-b][1,3]benzodiazepine (PubChem CID 21486764) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 2,8,11,12-tetrahydropyrimido[2,1-b][1,3]benzodiazepine.
| Compound Name | 2,8,11,12-tetrahydropyrimido[2,1-b][1,3]benzodiazepine |
|---|---|
| PubChem CID | 21486764 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2,8,11,12-tetrahydropyrimido[2,1-b][1,3]benzodiazepine |
| SMILES | C1=CN2C=CC3=C(CC=CC3)NC2=NC1 |
| InChI | InChI=1S/C12H13N3/c1-2-5-11-10(4-1)6-9-15-8-3-7-13-12(15)14-11/h1-3,6,8-9H,4-5,7H2,(H,13,14) |
| InChIKey | YBPULGFCROMWFZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|