About 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide
2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide (PubChem CID 21486884) has the molecular formula C9H14N2O2S2
and a molecular weight of 246.36 g/mol. Its IUPAC name is 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide.
Molecular Properties
| Compound Name | 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide |
| PubChem CID | 21486884 |
| Molecular Formula | C9H14N2O2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide |
| SMILES | COC(C)(Sc1nccs1)C(=O)N(C)C |
| InChI | InChI=1S/C9H14N2O2S2/c1-9(13-4,7(12)11(2)3)15-8-10-5-6-14-8/h5-6H,1-4H3 |
| InChIKey | OOQNQYVQNPFDMW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide?
The IUPAC name of 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide (CID 21486884) is 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide.
What is the SMILES notation for 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide?
The canonical SMILES for 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide is COC(C)(Sc1nccs1)C(=O)N(C)C.
What is the InChIKey of 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide?
The InChIKey is OOQNQYVQNPFDMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S2/c1-9(13-4,7(12)11(2)3)15-8-10-5-6-14-8/h5-6H,1-4H3.
What are the key properties of 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide?
2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide has a molecular weight of 246.36 g/mol, XLogP of 1.69, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N,N-dimethyl-2-(1,3-thiazol-2-ylsulfanyl)propanamide is sourced from PubChem (CID 21486884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).