About 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide
2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide (PubChem CID 21486896) has the molecular formula C7H10N2OS2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide.
Molecular Properties
| Compound Name | 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide |
| PubChem CID | 21486896 |
| Molecular Formula | C7H10N2OS2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.02 |
| IUPAC Name | 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide |
| SMILES | CNC(=S)C(OC)c1nccs1 |
| InChI | InChI=1S/C7H10N2OS2/c1-8-6(11)5(10-2)7-9-3-4-12-7/h3-5H,1-2H3,(H,8,11) |
| InChIKey | RPHPXHHBEMOJNH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide?
The IUPAC name of 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide (CID 21486896) is 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide.
What is the SMILES notation for 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide?
The canonical SMILES for 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide is CNC(=S)C(OC)c1nccs1.
What is the InChIKey of 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide?
The InChIKey is RPHPXHHBEMOJNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2OS2/c1-8-6(11)5(10-2)7-9-3-4-12-7/h3-5H,1-2H3,(H,8,11).
What are the key properties of 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide?
2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide has a molecular weight of 202.30 g/mol, XLogP of 1.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-N-methyl-2-(1,3-thiazol-2-yl)ethanethioamide is sourced from PubChem (CID 21486896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).