2-pyrimidin-4-ylacetic acid

C6H6N2O2 — CID 21486925

IUPAC2-pyrimidin-4-ylacetic acid
SMILESO=C(O)Cc1ccncn1
InChIInChI=1S/C6H6N2O2/c9-6(10)3-5-1-2-7-4-8-5/h1-2,4H,3H2,(H,9,10)
InChIKeyINKXJLOOBMPRMB-UHFFFAOYSA-N
MW138.13 g/mol
LogP0.10
Rot. Bonds2

About 2-pyrimidin-4-ylacetic acid

2-pyrimidin-4-ylacetic acid (PubChem CID 21486925) has the molecular formula C6H6N2O2 and a molecular weight of 138.13 g/mol. Its IUPAC name is 2-pyrimidin-4-ylacetic acid.

Molecular Properties

Compound Name2-pyrimidin-4-ylacetic acid
PubChem CID21486925
Molecular FormulaC6H6N2O2
Molecular Weight138.13 g/mol
Exact Mass138.04
IUPAC Name2-pyrimidin-4-ylacetic acid
SMILESO=C(O)Cc1ccncn1
InChIInChI=1S/C6H6N2O2/c9-6(10)3-5-1-2-7-4-8-5/h1-2,4H,3H2,(H,9,10)
InChIKeyINKXJLOOBMPRMB-UHFFFAOYSA-N
XLogP0.10
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500138.13
LogP ≤ 50.10
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-pyrimidin-4-ylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-pyrimidin-4-ylacetic acid?
The IUPAC name of 2-pyrimidin-4-ylacetic acid (CID 21486925) is 2-pyrimidin-4-ylacetic acid.
What is the SMILES notation for 2-pyrimidin-4-ylacetic acid?
The canonical SMILES for 2-pyrimidin-4-ylacetic acid is O=C(O)Cc1ccncn1.
What is the InChIKey of 2-pyrimidin-4-ylacetic acid?
The InChIKey is INKXJLOOBMPRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c9-6(10)3-5-1-2-7-4-8-5/h1-2,4H,3H2,(H,9,10).
What are the key properties of 2-pyrimidin-4-ylacetic acid?
2-pyrimidin-4-ylacetic acid has a molecular weight of 138.13 g/mol, XLogP of 0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrimidin-4-ylacetic acid is sourced from PubChem (CID 21486925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).