About 2-pyrimidin-4-ylacetic acid
2-pyrimidin-4-ylacetic acid (PubChem CID 21486925) has the molecular formula C6H6N2O2
and a molecular weight of 138.13 g/mol. Its IUPAC name is 2-pyrimidin-4-ylacetic acid.
Molecular Properties
| Compound Name | 2-pyrimidin-4-ylacetic acid |
| PubChem CID | 21486925 |
| Molecular Formula | C6H6N2O2 |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.04 |
| IUPAC Name | 2-pyrimidin-4-ylacetic acid |
| SMILES | O=C(O)Cc1ccncn1 |
| InChI | InChI=1S/C6H6N2O2/c9-6(10)3-5-1-2-7-4-8-5/h1-2,4H,3H2,(H,9,10) |
| InChIKey | INKXJLOOBMPRMB-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-pyrimidin-4-ylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrimidin-4-ylacetic acid?
The IUPAC name of 2-pyrimidin-4-ylacetic acid (CID 21486925) is 2-pyrimidin-4-ylacetic acid.
What is the SMILES notation for 2-pyrimidin-4-ylacetic acid?
The canonical SMILES for 2-pyrimidin-4-ylacetic acid is O=C(O)Cc1ccncn1.
What is the InChIKey of 2-pyrimidin-4-ylacetic acid?
The InChIKey is INKXJLOOBMPRMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N2O2/c9-6(10)3-5-1-2-7-4-8-5/h1-2,4H,3H2,(H,9,10).
What are the key properties of 2-pyrimidin-4-ylacetic acid?
2-pyrimidin-4-ylacetic acid has a molecular weight of 138.13 g/mol, XLogP of 0.10, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrimidin-4-ylacetic acid is sourced from PubChem (CID 21486925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).