About 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one
8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one (PubChem CID 21487033) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one.
Molecular Properties
| Compound Name | 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one |
| PubChem CID | 21487033 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one |
| SMILES | CC(=O)N1C2C=CC1C(C)C(=O)C2C |
| InChI | InChI=1S/C11H15NO2/c1-6-9-4-5-10(7(2)11(6)14)12(9)8(3)13/h4-7,9-10H,1-3H3 |
| InChIKey | WSKJZBFLZXQKKG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one?
The IUPAC name of 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one (CID 21487033) is 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one.
What is the SMILES notation for 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one?
The canonical SMILES for 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one is CC(=O)N1C2C=CC1C(C)C(=O)C2C.
What is the InChIKey of 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one?
The InChIKey is WSKJZBFLZXQKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2/c1-6-9-4-5-10(7(2)11(6)14)12(9)8(3)13/h4-7,9-10H,1-3H3.
What are the key properties of 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one?
8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one has a molecular weight of 193.25 g/mol, XLogP of 1.00, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-acetyl-2,4-dimethyl-8-azabicyclo[3.2.1]oct-6-en-3-one is sourced from PubChem (CID 21487033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).