About 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine
8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine (PubChem CID 21487149) has the molecular formula C16H11BrN4
and a molecular weight of 339.20 g/mol. Its IUPAC name is 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine |
| PubChem CID | 21487149 |
| Molecular Formula | C16H11BrN4 |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.02 |
| IUPAC Name | 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine |
| SMILES | Brc1ccc2c(c1)C(c1ccccn1)=NCc1nccn1-2 |
| InChI | InChI=1S/C16H11BrN4/c17-11-4-5-14-12(9-11)16(13-3-1-2-6-18-13)20-10-15-19-7-8-21(14)15/h1-9H,10H2 |
| InChIKey | KHQLEUJDZAJLBV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine?
The IUPAC name of 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine (CID 21487149) is 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine.
What is the SMILES notation for 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine?
The canonical SMILES for 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine is Brc1ccc2c(c1)C(c1ccccn1)=NCc1nccn1-2.
What is the InChIKey of 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine?
The InChIKey is KHQLEUJDZAJLBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11BrN4/c17-11-4-5-14-12(9-11)16(13-3-1-2-6-18-13)20-10-15-19-7-8-21(14)15/h1-9H,10H2.
What are the key properties of 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine?
8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine has a molecular weight of 339.20 g/mol, XLogP of 3.38, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-bromo-6-pyridin-2-yl-4H-imidazo[1,2-a][1,4]benzodiazepine is sourced from PubChem (CID 21487149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).