C14H9F21O2S — CID 21487419
1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)butane-1,4-diol (PubChem CID 21487419) has the molecular formula C14H9F21O2S and a molecular weight of 640.25 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)butane-1,4-diol.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)butane-1,4-diol |
|---|---|
| PubChem CID | 21487419 |
| Molecular Formula | C14H9F21O2S |
| Molecular Weight | 640.25 g/mol |
| Exact Mass | 640.00 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)butane-1,4-diol |
| SMILES | OCCCC(O)SC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H9F21O2S/c15-5(16,7(19,20)9(23,24)11(27,28)13(31,32)33)6(17,18)8(21,22)10(25,26)12(29,30)14(34,35)38-4(37)2-1-3-36/h4,36-37H,1-3H2 |
| InChIKey | CTZPZMYUGIKNLQ-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.25 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|