About 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane
3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane (PubChem CID 21487590) has the molecular formula C18H30O2
and a molecular weight of 278.44 g/mol. Its IUPAC name is 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane.
Molecular Properties
| Compound Name | 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane |
| PubChem CID | 21487590 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane |
| SMILES | CCC1(OCCC(C)CCC2OC2(C)C)C=CC=CC1 |
| InChI | InChI=1S/C18H30O2/c1-5-18(12-7-6-8-13-18)19-14-11-15(2)9-10-16-17(3,4)20-16/h6-8,12,15-16H,5,9-11,13-14H2,1-4H3 |
| InChIKey | OJPZBXOFGFWRGZ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane?
The IUPAC name of 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane (CID 21487590) is 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane.
What is the SMILES notation for 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane?
The canonical SMILES for 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane is CCC1(OCCC(C)CCC2OC2(C)C)C=CC=CC1.
What is the InChIKey of 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane?
The InChIKey is OJPZBXOFGFWRGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O2/c1-5-18(12-7-6-8-13-18)19-14-11-15(2)9-10-16-17(3,4)20-16/h6-8,12,15-16H,5,9-11,13-14H2,1-4H3.
What are the key properties of 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane?
3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane has a molecular weight of 278.44 g/mol, XLogP of 4.65, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(1-ethylcyclohexa-2,4-dien-1-yl)oxy-3-methylpentyl]-2,2-dimethyloxirane is sourced from PubChem (CID 21487590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).