About 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene
3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene (PubChem CID 21487829) has the molecular formula C22H23ClO3S
and a molecular weight of 402.94 g/mol. Its IUPAC name is 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene.
Molecular Properties
| Compound Name | 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene |
| PubChem CID | 21487829 |
| Molecular Formula | C22H23ClO3S |
| Molecular Weight | 402.94 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene |
| SMILES | C=COCCC1(CCOC=C)c2ccc(Cl)cc2Sc2c(OC)cccc21 |
| InChI | InChI=1S/C22H23ClO3S/c1-4-25-13-11-22(12-14-26-5-2)17-10-9-16(23)15-20(17)27-21-18(22)7-6-8-19(21)24-3/h4-10,15H,1-2,11-14H2,3H3 |
| InChIKey | JBQXEYMKQKZVRB-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.94 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene?
The IUPAC name of 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene (CID 21487829) is 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene.
What is the SMILES notation for 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene?
The canonical SMILES for 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene is C=COCCC1(CCOC=C)c2ccc(Cl)cc2Sc2c(OC)cccc21.
What is the InChIKey of 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene?
The InChIKey is JBQXEYMKQKZVRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23ClO3S/c1-4-25-13-11-22(12-14-26-5-2)17-10-9-16(23)15-20(17)27-21-18(22)7-6-8-19(21)24-3/h4-10,15H,1-2,11-14H2,3H3.
What are the key properties of 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene?
3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene has a molecular weight of 402.94 g/mol, XLogP of 6.20, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-9,9-bis(2-ethenoxyethyl)-5-methoxythioxanthene is sourced from PubChem (CID 21487829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).