2-hydroxydecanoic acid

C10H20O3 — CID 21488

IUPAC2-hydroxydecanoic acid
SMILESCCCCCCCCC(O)C(=O)O
InChIInChI=1S/C10H20O3/c1-2-3-4-5-6-7-8-9(11)10(12)13/h9,11H,2-8H2,1H3,(H,12,13)
InChIKeyGHPVDCPCKSNJDR-UHFFFAOYSA-N
MW188.27 g/mol
LogP2.18
Rot. Bonds8

About 2-hydroxydecanoic acid

2-hydroxydecanoic acid (PubChem CID 21488) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-hydroxydecanoic acid.

Molecular Properties

Compound Name2-hydroxydecanoic acid
PubChem CID21488
Molecular FormulaC10H20O3
Molecular Weight188.27 g/mol
Exact Mass188.14
IUPAC Name2-hydroxydecanoic acid
SMILESCCCCCCCCC(O)C(=O)O
InChIInChI=1S/C10H20O3/c1-2-3-4-5-6-7-8-9(11)10(12)13/h9,11H,2-8H2,1H3,(H,12,13)
InChIKeyGHPVDCPCKSNJDR-UHFFFAOYSA-N
XLogP2.18
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.27
LogP ≤ 52.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-hydroxydecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxydecanoic acid?
The IUPAC name of 2-hydroxydecanoic acid (CID 21488) is 2-hydroxydecanoic acid.
What is the SMILES notation for 2-hydroxydecanoic acid?
The canonical SMILES for 2-hydroxydecanoic acid is CCCCCCCCC(O)C(=O)O.
What is the InChIKey of 2-hydroxydecanoic acid?
The InChIKey is GHPVDCPCKSNJDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O3/c1-2-3-4-5-6-7-8-9(11)10(12)13/h9,11H,2-8H2,1H3,(H,12,13).
What are the key properties of 2-hydroxydecanoic acid?
2-hydroxydecanoic acid has a molecular weight of 188.27 g/mol, XLogP of 2.18, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxydecanoic acid is sourced from PubChem (CID 21488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).