About (1-octylcyclopropyl) octanoate
(1-octylcyclopropyl) octanoate (PubChem CID 21488075) has the molecular formula C19H36O2
and a molecular weight of 296.49 g/mol. Its IUPAC name is (1-octylcyclopropyl) octanoate.
Molecular Properties
| Compound Name | (1-octylcyclopropyl) octanoate |
| PubChem CID | 21488075 |
| Molecular Formula | C19H36O2 |
| Molecular Weight | 296.49 g/mol |
| Exact Mass | 296.27 |
| IUPAC Name | (1-octylcyclopropyl) octanoate |
| SMILES | CCCCCCCCC1(OC(=O)CCCCCCC)CC1 |
| InChI | InChI=1S/C19H36O2/c1-3-5-7-9-11-13-15-19(16-17-19)21-18(20)14-12-10-8-6-4-2/h3-17H2,1-2H3 |
| InChIKey | VCRLWUKHIJUDQJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.49 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (1-octylcyclopropyl) octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-octylcyclopropyl) octanoate?
The IUPAC name of (1-octylcyclopropyl) octanoate (CID 21488075) is (1-octylcyclopropyl) octanoate.
What is the SMILES notation for (1-octylcyclopropyl) octanoate?
The canonical SMILES for (1-octylcyclopropyl) octanoate is CCCCCCCCC1(OC(=O)CCCCCCC)CC1.
What is the InChIKey of (1-octylcyclopropyl) octanoate?
The InChIKey is VCRLWUKHIJUDQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H36O2/c1-3-5-7-9-11-13-15-19(16-17-19)21-18(20)14-12-10-8-6-4-2/h3-17H2,1-2H3.
What are the key properties of (1-octylcyclopropyl) octanoate?
(1-octylcyclopropyl) octanoate has a molecular weight of 296.49 g/mol, XLogP of 6.17, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-octylcyclopropyl) octanoate is sourced from PubChem (CID 21488075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).