About 1,5-dichloro-2,3,4-trimethylbenzene
1,5-dichloro-2,3,4-trimethylbenzene (PubChem CID 21488192) has the molecular formula C9H10Cl2
and a molecular weight of 189.08 g/mol. Its IUPAC name is 1,5-dichloro-2,3,4-trimethylbenzene.
Molecular Properties
| Compound Name | 1,5-dichloro-2,3,4-trimethylbenzene |
| PubChem CID | 21488192 |
| Molecular Formula | C9H10Cl2 |
| Molecular Weight | 189.08 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 1,5-dichloro-2,3,4-trimethylbenzene |
| SMILES | Cc1c(Cl)cc(Cl)c(C)c1C |
| InChI | InChI=1S/C9H10Cl2/c1-5-6(2)8(10)4-9(11)7(5)3/h4H,1-3H3 |
| InChIKey | IURPGYHEBMCDGZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.08 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,5-dichloro-2,3,4-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dichloro-2,3,4-trimethylbenzene?
The IUPAC name of 1,5-dichloro-2,3,4-trimethylbenzene (CID 21488192) is 1,5-dichloro-2,3,4-trimethylbenzene.
What is the SMILES notation for 1,5-dichloro-2,3,4-trimethylbenzene?
The canonical SMILES for 1,5-dichloro-2,3,4-trimethylbenzene is Cc1c(Cl)cc(Cl)c(C)c1C.
What is the InChIKey of 1,5-dichloro-2,3,4-trimethylbenzene?
The InChIKey is IURPGYHEBMCDGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10Cl2/c1-5-6(2)8(10)4-9(11)7(5)3/h4H,1-3H3.
What are the key properties of 1,5-dichloro-2,3,4-trimethylbenzene?
1,5-dichloro-2,3,4-trimethylbenzene has a molecular weight of 189.08 g/mol, XLogP of 3.92, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dichloro-2,3,4-trimethylbenzene is sourced from PubChem (CID 21488192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).