C15H10ClF2N3 — CID 21488596
[6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine (PubChem CID 21488596) has the molecular formula C15H10ClF2N3 and a molecular weight of 305.72 g/mol. Its IUPAC name is [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine.
| Compound Name | [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine |
|---|---|
| PubChem CID | 21488596 |
| Molecular Formula | C15H10ClF2N3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine |
| SMILES | NNc1cc(-c2c(F)cccc2F)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C15H10ClF2N3/c16-8-4-5-13-9(6-8)10(7-14(20-13)21-19)15-11(17)2-1-3-12(15)18/h1-7H,19H2,(H,20,21) |
| InChIKey | TYEZFHYDMADINF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|