About [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine
[6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine (PubChem CID 21488596) has the molecular formula C15H10ClF2N3
and a molecular weight of 305.72 g/mol. Its IUPAC name is [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine.
Molecular Properties
| Compound Name | [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine |
| PubChem CID | 21488596 |
| Molecular Formula | C15H10ClF2N3 |
| Molecular Weight | 305.72 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine |
| SMILES | NNc1cc(-c2c(F)cccc2F)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C15H10ClF2N3/c16-8-4-5-13-9(6-8)10(7-14(20-13)21-19)15-11(17)2-1-3-12(15)18/h1-7H,19H2,(H,20,21) |
| InChIKey | TYEZFHYDMADINF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.72 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine?
The IUPAC name of [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine (CID 21488596) is [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine.
What is the SMILES notation for [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine?
The canonical SMILES for [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine is NNc1cc(-c2c(F)cccc2F)c2cc(Cl)ccc2n1.
What is the InChIKey of [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine?
The InChIKey is TYEZFHYDMADINF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10ClF2N3/c16-8-4-5-13-9(6-8)10(7-14(20-13)21-19)15-11(17)2-1-3-12(15)18/h1-7H,19H2,(H,20,21).
What are the key properties of [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine?
[6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine has a molecular weight of 305.72 g/mol, XLogP of 4.12, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-chloro-4-(2,6-difluorophenyl)quinolin-2-yl]hydrazine is sourced from PubChem (CID 21488596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).