About (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone
(2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone (PubChem CID 21488613) has the molecular formula C16H9ClF3N3O
and a molecular weight of 351.72 g/mol. Its IUPAC name is (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone.
Molecular Properties
| Compound Name | (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone |
| PubChem CID | 21488613 |
| Molecular Formula | C16H9ClF3N3O |
| Molecular Weight | 351.72 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1Cl)c1cc(C(F)(F)F)ccc1-n1cnnc1 |
| InChI | InChI=1S/C16H9ClF3N3O/c17-13-4-2-1-3-11(13)15(24)12-7-10(16(18,19)20)5-6-14(12)23-8-21-22-9-23/h1-9H |
| InChIKey | MTHMRXCSKYMULH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.72 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone?
The IUPAC name of (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone (CID 21488613) is (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone.
What is the SMILES notation for (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone?
The canonical SMILES for (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone is O=C(c1ccccc1Cl)c1cc(C(F)(F)F)ccc1-n1cnnc1.
What is the InChIKey of (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone?
The InChIKey is MTHMRXCSKYMULH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H9ClF3N3O/c17-13-4-2-1-3-11(13)15(24)12-7-10(16(18,19)20)5-6-14(12)23-8-21-22-9-23/h1-9H.
What are the key properties of (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone?
(2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone has a molecular weight of 351.72 g/mol, XLogP of 4.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chlorophenyl)-[2-(1,2,4-triazol-4-yl)-5-(trifluoromethyl)phenyl]methanone is sourced from PubChem (CID 21488613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).