About 2-methylpropanamide;thiolane 1,1-dioxide
2-methylpropanamide;thiolane 1,1-dioxide (PubChem CID 21488850) has the molecular formula C8H17NO3S
and a molecular weight of 207.29 g/mol. Its IUPAC name is 2-methylpropanamide;thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 2-methylpropanamide;thiolane 1,1-dioxide |
| PubChem CID | 21488850 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 2-methylpropanamide;thiolane 1,1-dioxide |
| SMILES | CC(C)C(N)=O.O=S1(=O)CCCC1 |
| InChI | InChI=1S/C4H9NO.C4H8O2S/c1-3(2)4(5)6;5-7(6)3-1-2-4-7/h3H,1-2H3,(H2,5,6);1-4H2 |
| InChIKey | RVVNLHKGZFGWES-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylpropanamide;thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanamide;thiolane 1,1-dioxide?
The IUPAC name of 2-methylpropanamide;thiolane 1,1-dioxide (CID 21488850) is 2-methylpropanamide;thiolane 1,1-dioxide.
What is the SMILES notation for 2-methylpropanamide;thiolane 1,1-dioxide?
The canonical SMILES for 2-methylpropanamide;thiolane 1,1-dioxide is CC(C)C(N)=O.O=S1(=O)CCCC1.
What is the InChIKey of 2-methylpropanamide;thiolane 1,1-dioxide?
The InChIKey is RVVNLHKGZFGWES-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C4H8O2S/c1-3(2)4(5)6;5-7(6)3-1-2-4-7/h3H,1-2H3,(H2,5,6);1-4H2.
What are the key properties of 2-methylpropanamide;thiolane 1,1-dioxide?
2-methylpropanamide;thiolane 1,1-dioxide has a molecular weight of 207.29 g/mol, XLogP of 0.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanamide;thiolane 1,1-dioxide is sourced from PubChem (CID 21488850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).