C6H10N8 — CID 21489094
6-azido-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine (PubChem CID 21489094) has the molecular formula C6H10N8 and a molecular weight of 194.20 g/mol. Its IUPAC name is 6-azido-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-azido-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 21489094 |
| Molecular Formula | C6H10N8 |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | 6-azido-2-N-propan-2-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(C)Nc1nc(N)nc(N=[N+]=[N-])n1 |
| InChI | InChI=1S/C6H10N8/c1-3(2)9-5-10-4(7)11-6(12-5)13-14-8/h3H,1-2H3,(H3,7,9,10,11,12) |
| InChIKey | UADGUVIGYUZGKW-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 125.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|