About 4-methoxy-1,3,5-triphenylpyrazole
4-methoxy-1,3,5-triphenylpyrazole (PubChem CID 21489465) has the molecular formula C22H18N2O
and a molecular weight of 326.40 g/mol. Its IUPAC name is 4-methoxy-1,3,5-triphenylpyrazole.
Molecular Properties
| Compound Name | 4-methoxy-1,3,5-triphenylpyrazole |
| PubChem CID | 21489465 |
| Molecular Formula | C22H18N2O |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 4-methoxy-1,3,5-triphenylpyrazole |
| SMILES | COc1c(-c2ccccc2)nn(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C22H18N2O/c1-25-22-20(17-11-5-2-6-12-17)23-24(19-15-9-4-10-16-19)21(22)18-13-7-3-8-14-18/h2-16H,1H3 |
| InChIKey | YBZVLYSIOALSCL-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-1,3,5-triphenylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1,3,5-triphenylpyrazole?
The IUPAC name of 4-methoxy-1,3,5-triphenylpyrazole (CID 21489465) is 4-methoxy-1,3,5-triphenylpyrazole.
What is the SMILES notation for 4-methoxy-1,3,5-triphenylpyrazole?
The canonical SMILES for 4-methoxy-1,3,5-triphenylpyrazole is COc1c(-c2ccccc2)nn(-c2ccccc2)c1-c1ccccc1.
What is the InChIKey of 4-methoxy-1,3,5-triphenylpyrazole?
The InChIKey is YBZVLYSIOALSCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18N2O/c1-25-22-20(17-11-5-2-6-12-17)23-24(19-15-9-4-10-16-19)21(22)18-13-7-3-8-14-18/h2-16H,1H3.
What are the key properties of 4-methoxy-1,3,5-triphenylpyrazole?
4-methoxy-1,3,5-triphenylpyrazole has a molecular weight of 326.40 g/mol, XLogP of 5.21, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1,3,5-triphenylpyrazole is sourced from PubChem (CID 21489465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).