About 2-butyl-6,8-dichloro-4H-1,3-benzodioxine
2-butyl-6,8-dichloro-4H-1,3-benzodioxine (PubChem CID 21489561) has the molecular formula C12H14Cl2O2
and a molecular weight of 261.15 g/mol. Its IUPAC name is 2-butyl-6,8-dichloro-4H-1,3-benzodioxine.
Molecular Properties
| Compound Name | 2-butyl-6,8-dichloro-4H-1,3-benzodioxine |
| PubChem CID | 21489561 |
| Molecular Formula | C12H14Cl2O2 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 2-butyl-6,8-dichloro-4H-1,3-benzodioxine |
| SMILES | CCCCC1OCc2cc(Cl)cc(Cl)c2O1 |
| InChI | InChI=1S/C12H14Cl2O2/c1-2-3-4-11-15-7-8-5-9(13)6-10(14)12(8)16-11/h5-6,11H,2-4,7H2,1H3 |
| InChIKey | CPWCVCAOPIVKMS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-6,8-dichloro-4H-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-6,8-dichloro-4H-1,3-benzodioxine?
The IUPAC name of 2-butyl-6,8-dichloro-4H-1,3-benzodioxine (CID 21489561) is 2-butyl-6,8-dichloro-4H-1,3-benzodioxine.
What is the SMILES notation for 2-butyl-6,8-dichloro-4H-1,3-benzodioxine?
The canonical SMILES for 2-butyl-6,8-dichloro-4H-1,3-benzodioxine is CCCCC1OCc2cc(Cl)cc(Cl)c2O1.
What is the InChIKey of 2-butyl-6,8-dichloro-4H-1,3-benzodioxine?
The InChIKey is CPWCVCAOPIVKMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Cl2O2/c1-2-3-4-11-15-7-8-5-9(13)6-10(14)12(8)16-11/h5-6,11H,2-4,7H2,1H3.
What are the key properties of 2-butyl-6,8-dichloro-4H-1,3-benzodioxine?
2-butyl-6,8-dichloro-4H-1,3-benzodioxine has a molecular weight of 261.15 g/mol, XLogP of 4.42, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-6,8-dichloro-4H-1,3-benzodioxine is sourced from PubChem (CID 21489561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).