About 1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid
1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid (PubChem CID 21491277) has the molecular formula C13H17NO3
and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid.
Analyze 1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The IUPAC name of 1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid (CID 21491277) is 1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid.
What is the SMILES notation for 1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The canonical SMILES for 1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid is CCOc1ccc2c(c1)C(N)(C(=O)O)CCC2.
What is the InChIKey of 1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
The InChIKey is PNISIKCUCVZQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO3/c1-2-17-10-6-5-9-4-3-7-13(14,12(15)16)11(9)8-10/h5-6,8H,2-4,7,14H2,1H3,(H,15,16).
What are the key properties of 1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid?
1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid has a molecular weight of 235.28 g/mol, XLogP of 1.66, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-7-ethoxy-3,4-dihydro-2H-naphthalene-1-carboxylic acid is sourced from PubChem (CID 21491277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).