About 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide
4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide (PubChem CID 21492069) has the molecular formula C12H18FNO2S
and a molecular weight of 259.35 g/mol. Its IUPAC name is 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide |
| PubChem CID | 21492069 |
| Molecular Formula | C12H18FNO2S |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(S(N)(=O)=O)c(C(C)C)cc1F |
| InChI | InChI=1S/C12H18FNO2S/c1-7(2)9-6-12(17(14,15)16)10(8(3)4)5-11(9)13/h5-8H,1-4H3,(H2,14,15,16) |
| InChIKey | XFSSYSANTJWBNS-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide?
The IUPAC name of 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide (CID 21492069) is 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide.
What is the SMILES notation for 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide?
The canonical SMILES for 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide is CC(C)c1cc(S(N)(=O)=O)c(C(C)C)cc1F.
What is the InChIKey of 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide?
The InChIKey is XFSSYSANTJWBNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18FNO2S/c1-7(2)9-6-12(17(14,15)16)10(8(3)4)5-11(9)13/h5-8H,1-4H3,(H2,14,15,16).
What are the key properties of 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide?
4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide has a molecular weight of 259.35 g/mol, XLogP of 2.72, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-2,5-di(propan-2-yl)benzenesulfonamide is sourced from PubChem (CID 21492069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).