C15H15F18NO3 — CID 21492158
2-(1,1,2,2,3,3-hexafluoropropoxy)-N,N-bis[2-(1,1,2,2,3,3-hexafluoropropoxy)ethyl]ethanamine (PubChem CID 21492158) has the molecular formula C15H15F18NO3 and a molecular weight of 599.25 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3-hexafluoropropoxy)-N,N-bis[2-(1,1,2,2,3,3-hexafluoropropoxy)ethyl]ethanamine.
| Compound Name | 2-(1,1,2,2,3,3-hexafluoropropoxy)-N,N-bis[2-(1,1,2,2,3,3-hexafluoropropoxy)ethyl]ethanamine |
|---|---|
| PubChem CID | 21492158 |
| Molecular Formula | C15H15F18NO3 |
| Molecular Weight | 599.25 g/mol |
| Exact Mass | 599.08 |
| IUPAC Name | 2-(1,1,2,2,3,3-hexafluoropropoxy)-N,N-bis[2-(1,1,2,2,3,3-hexafluoropropoxy)ethyl]ethanamine |
| SMILES | FC(F)C(F)(F)C(F)(F)OCCN(CCOC(F)(F)C(F)(F)C(F)F)CCOC(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C15H15F18NO3/c16-7(17)10(22,23)13(28,29)35-4-1-34(2-5-36-14(30,31)11(24,25)8(18)19)3-6-37-15(32,33)12(26,27)9(20)21/h7-9H,1-6H2 |
| InChIKey | JNTNMRQDFXTNDL-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.25 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|