About dispiro[5.1.58.16]tetradecane-7,14-diol
dispiro[5.1.58.16]tetradecane-7,14-diol (PubChem CID 21492522) has the molecular formula C14H24O2
and a molecular weight of 224.34 g/mol. Its IUPAC name is dispiro[5.1.58.16]tetradecane-7,14-diol.
Molecular Properties
| Compound Name | dispiro[5.1.58.16]tetradecane-7,14-diol |
| PubChem CID | 21492522 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | dispiro[5.1.58.16]tetradecane-7,14-diol |
| SMILES | OC1C2(CCCCC2)C(O)C12CCCCC2 |
| InChI | InChI=1S/C14H24O2/c15-11-13(7-3-1-4-8-13)12(16)14(11)9-5-2-6-10-14/h11-12,15-16H,1-10H2 |
| InChIKey | DUYYIGQJIYQRRF-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze dispiro[5.1.58.16]tetradecane-7,14-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dispiro[5.1.58.16]tetradecane-7,14-diol?
The IUPAC name of dispiro[5.1.58.16]tetradecane-7,14-diol (CID 21492522) is dispiro[5.1.58.16]tetradecane-7,14-diol.
What is the SMILES notation for dispiro[5.1.58.16]tetradecane-7,14-diol?
The canonical SMILES for dispiro[5.1.58.16]tetradecane-7,14-diol is OC1C2(CCCCC2)C(O)C12CCCCC2.
What is the InChIKey of dispiro[5.1.58.16]tetradecane-7,14-diol?
The InChIKey is DUYYIGQJIYQRRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O2/c15-11-13(7-3-1-4-8-13)12(16)14(11)9-5-2-6-10-14/h11-12,15-16H,1-10H2.
What are the key properties of dispiro[5.1.58.16]tetradecane-7,14-diol?
dispiro[5.1.58.16]tetradecane-7,14-diol has a molecular weight of 224.34 g/mol, XLogP of 2.62, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dispiro[5.1.58.16]tetradecane-7,14-diol is sourced from PubChem (CID 21492522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).