C19H22N2O — CID 21492549
1,4,5,6,7,8-hexahydro-1,3-diazocin-2-yl(diphenyl)methanol (PubChem CID 21492549) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is 1,4,5,6,7,8-hexahydro-1,3-diazocin-2-yl(diphenyl)methanol.
| Compound Name | 1,4,5,6,7,8-hexahydro-1,3-diazocin-2-yl(diphenyl)methanol |
|---|---|
| PubChem CID | 21492549 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 1,4,5,6,7,8-hexahydro-1,3-diazocin-2-yl(diphenyl)methanol |
| SMILES | OC(/C1=N/CCCCCN1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O/c22-19(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-20-14-8-3-9-15-21-18/h1-2,4-7,10-13,22H,3,8-9,14-15H2,(H,20,21) |
| InChIKey | QIMNAIRFTIDDHZ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |