About 2-amino-4,5-dimethoxyphenol;hydrochloride
2-amino-4,5-dimethoxyphenol;hydrochloride (PubChem CID 21492629) has the molecular formula C8H12ClNO3
and a molecular weight of 205.64 g/mol. Its IUPAC name is 2-amino-4,5-dimethoxyphenol;hydrochloride.
Molecular Properties
| Compound Name | 2-amino-4,5-dimethoxyphenol;hydrochloride |
| PubChem CID | 21492629 |
| Molecular Formula | C8H12ClNO3 |
| Molecular Weight | 205.64 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 2-amino-4,5-dimethoxyphenol;hydrochloride |
| SMILES | COc1cc(N)c(O)cc1OC.Cl |
| InChI | InChI=1S/C8H11NO3.ClH/c1-11-7-3-5(9)6(10)4-8(7)12-2;/h3-4,10H,9H2,1-2H3;1H |
| InChIKey | IDTGJUWPEZDCLY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.64 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4,5-dimethoxyphenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4,5-dimethoxyphenol;hydrochloride?
The IUPAC name of 2-amino-4,5-dimethoxyphenol;hydrochloride (CID 21492629) is 2-amino-4,5-dimethoxyphenol;hydrochloride.
What is the SMILES notation for 2-amino-4,5-dimethoxyphenol;hydrochloride?
The canonical SMILES for 2-amino-4,5-dimethoxyphenol;hydrochloride is COc1cc(N)c(O)cc1OC.Cl.
What is the InChIKey of 2-amino-4,5-dimethoxyphenol;hydrochloride?
The InChIKey is IDTGJUWPEZDCLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3.ClH/c1-11-7-3-5(9)6(10)4-8(7)12-2;/h3-4,10H,9H2,1-2H3;1H.
What are the key properties of 2-amino-4,5-dimethoxyphenol;hydrochloride?
2-amino-4,5-dimethoxyphenol;hydrochloride has a molecular weight of 205.64 g/mol, XLogP of 1.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4,5-dimethoxyphenol;hydrochloride is sourced from PubChem (CID 21492629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).