C11H10F5N5 — CID 21492896
(1E)-1-[amino-(2,3,4,5,6-pentafluoroanilino)methylidene]-2-cyclopropylguanidine (PubChem CID 21492896) has the molecular formula C11H10F5N5 and a molecular weight of 307.23 g/mol. Its IUPAC name is (1E)-1-[amino-(2,3,4,5,6-pentafluoroanilino)methylidene]-2-cyclopropylguanidine.
| Compound Name | (1E)-1-[amino-(2,3,4,5,6-pentafluoroanilino)methylidene]-2-cyclopropylguanidine |
|---|---|
| PubChem CID | 21492896 |
| Molecular Formula | C11H10F5N5 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | (1E)-1-[amino-(2,3,4,5,6-pentafluoroanilino)methylidene]-2-cyclopropylguanidine |
| SMILES | NC(=N\C1CC1)/N=C(\N)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H10F5N5/c12-4-5(13)7(15)9(8(16)6(4)14)20-11(18)21-10(17)19-3-1-2-3/h3H,1-2H2,(H5,17,18,19,20,21) |
| InChIKey | BKDJQTZOTWBMKX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|