About 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine
1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine (PubChem CID 21492941) has the molecular formula C19H23Cl2N5
and a molecular weight of 392.33 g/mol. Its IUPAC name is 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine.
Molecular Properties
| Compound Name | 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine |
| PubChem CID | 21492941 |
| Molecular Formula | C19H23Cl2N5 |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine |
| SMILES | CC(C)(/N=C(\N)N/C(N)=N/CCc1ccccc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H23Cl2N5/c1-19(2,16-14(20)9-6-10-15(16)21)26-18(23)25-17(22)24-12-11-13-7-4-3-5-8-13/h3-10H,11-12H2,1-2H3,(H5,22,23,24,25,26) |
| InChIKey | DKCVRQCYAODRPN-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine?
The IUPAC name of 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine (CID 21492941) is 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine.
What is the SMILES notation for 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine?
The canonical SMILES for 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine is CC(C)(/N=C(\N)N/C(N)=N/CCc1ccccc1)c1c(Cl)cccc1Cl.
What is the InChIKey of 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine?
The InChIKey is DKCVRQCYAODRPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23Cl2N5/c1-19(2,16-14(20)9-6-10-15(16)21)26-18(23)25-17(22)24-12-11-13-7-4-3-5-8-13/h3-10H,11-12H2,1-2H3,(H5,22,23,24,25,26).
What are the key properties of 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine?
1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine has a molecular weight of 392.33 g/mol, XLogP of 3.69, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[N'-[2-(2,6-dichlorophenyl)propan-2-yl]carbamimidoyl]-2-(2-phenylethyl)guanidine is sourced from PubChem (CID 21492941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).