About 2-cyano-1,1-dicyclopropylguanidine
2-cyano-1,1-dicyclopropylguanidine (PubChem CID 21492978) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 2-cyano-1,1-dicyclopropylguanidine.
Molecular Properties
| Compound Name | 2-cyano-1,1-dicyclopropylguanidine |
| PubChem CID | 21492978 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 2-cyano-1,1-dicyclopropylguanidine |
| SMILES | N#C/N=C(\N)N(C1CC1)C1CC1 |
| InChI | InChI=1S/C8H12N4/c9-5-11-8(10)12(6-1-2-6)7-3-4-7/h6-7H,1-4H2,(H2,10,11) |
| InChIKey | CUEBOFOJDKGMFP-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 65.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-1,1-dicyclopropylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-1,1-dicyclopropylguanidine?
The IUPAC name of 2-cyano-1,1-dicyclopropylguanidine (CID 21492978) is 2-cyano-1,1-dicyclopropylguanidine.
What is the SMILES notation for 2-cyano-1,1-dicyclopropylguanidine?
The canonical SMILES for 2-cyano-1,1-dicyclopropylguanidine is N#C/N=C(\N)N(C1CC1)C1CC1.
What is the InChIKey of 2-cyano-1,1-dicyclopropylguanidine?
The InChIKey is CUEBOFOJDKGMFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c9-5-11-8(10)12(6-1-2-6)7-3-4-7/h6-7H,1-4H2,(H2,10,11).
What are the key properties of 2-cyano-1,1-dicyclopropylguanidine?
2-cyano-1,1-dicyclopropylguanidine has a molecular weight of 164.21 g/mol, XLogP of 0.41, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-1,1-dicyclopropylguanidine is sourced from PubChem (CID 21492978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).