C4H10Cl2N4O4S2 — CID 21493045
3,7-bis(chloromethyl)-1,5,2,4,6,8-dithiatetrazocane 1,1,5,5-tetraoxide (PubChem CID 21493045) has the molecular formula C4H10Cl2N4O4S2 and a molecular weight of 313.19 g/mol. Its IUPAC name is 3,7-bis(chloromethyl)-1,5,2,4,6,8-dithiatetrazocane 1,1,5,5-tetraoxide.
| Compound Name | 3,7-bis(chloromethyl)-1,5,2,4,6,8-dithiatetrazocane 1,1,5,5-tetraoxide |
|---|---|
| PubChem CID | 21493045 |
| Molecular Formula | C4H10Cl2N4O4S2 |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 3,7-bis(chloromethyl)-1,5,2,4,6,8-dithiatetrazocane 1,1,5,5-tetraoxide |
| SMILES | O=S1(=O)NC(CCl)NS(=O)(=O)NC(CCl)N1 |
| InChI | InChI=1S/C4H10Cl2N4O4S2/c5-1-3-7-15(11,12)9-4(2-6)10-16(13,14)8-3/h3-4,7-10H,1-2H2 |
| InChIKey | QCFIBJBPJLKTCF-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|