About [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate
[N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate (PubChem CID 21493111) has the molecular formula C12H17N3OS2
and a molecular weight of 283.42 g/mol. Its IUPAC name is [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate.
Molecular Properties
| Compound Name | [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate |
| PubChem CID | 21493111 |
| Molecular Formula | C12H17N3OS2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate |
| SMILES | CN(C)C(=S)S/C(=N/c1cccc(O)c1)N(C)C |
| InChI | InChI=1S/C12H17N3OS2/c1-14(2)11(18-12(17)15(3)4)13-9-6-5-7-10(16)8-9/h5-8,16H,1-4H3/b13-11+ |
| InChIKey | OTQUXJNCJSPHOA-ACCUITESSA-N |
| XLogP | 2.52 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate?
The IUPAC name of [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate (CID 21493111) is [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate.
What is the SMILES notation for [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate?
The canonical SMILES for [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate is CN(C)C(=S)S/C(=N/c1cccc(O)c1)N(C)C.
What is the InChIKey of [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate?
The InChIKey is OTQUXJNCJSPHOA-ACCUITESSA-N. The full InChI is InChI=1S/C12H17N3OS2/c1-14(2)11(18-12(17)15(3)4)13-9-6-5-7-10(16)8-9/h5-8,16H,1-4H3/b13-11+.
What are the key properties of [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate?
[N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate has a molecular weight of 283.42 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [N'-(3-hydroxyphenyl)-N,N-dimethylcarbamimidoyl] N,N-dimethylcarbamodithioate is sourced from PubChem (CID 21493111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).