About 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole
2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole (PubChem CID 21493546) has the molecular formula C17H15N
and a molecular weight of 233.31 g/mol. Its IUPAC name is 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole.
Molecular Properties
| Compound Name | 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole |
| PubChem CID | 21493546 |
| Molecular Formula | C17H15N |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole |
| SMILES | CN1Cc2c(c3ccccc3c3ccccc23)C1 |
| InChI | InChI=1S/C17H15N/c1-18-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)17(16)11-18/h2-9H,10-11H2,1H3 |
| InChIKey | IDLULYPJBMAMIU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole?
The IUPAC name of 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole (CID 21493546) is 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole.
What is the SMILES notation for 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole?
The canonical SMILES for 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole is CN1Cc2c(c3ccccc3c3ccccc23)C1.
What is the InChIKey of 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole?
The InChIKey is IDLULYPJBMAMIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N/c1-18-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)17(16)11-18/h2-9H,10-11H2,1H3.
What are the key properties of 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole?
2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole has a molecular weight of 233.31 g/mol, XLogP of 3.94, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-dihydrophenanthro[9,10-c]pyrrole is sourced from PubChem (CID 21493546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).