About bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate
bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate (PubChem CID 21493724) has the molecular formula C28H28Cl6O10
and a molecular weight of 737.24 g/mol. Its IUPAC name is bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate.
Molecular Properties
| Compound Name | bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate |
| PubChem CID | 21493724 |
| Molecular Formula | C28H28Cl6O10 |
| Molecular Weight | 737.24 g/mol |
| Exact Mass | 733.98 |
| IUPAC Name | bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate |
| SMILES | CCCCOC(=O)c1c(Cl)c(Cl)c(OCC)c(Cl)c1OC(=O)C(=O)Oc1c(Cl)c(OCC)c(Cl)c(Cl)c1C(=O)OCCCC |
| InChI | InChI=1S/C28H28Cl6O10/c1-5-9-11-41-25(35)13-15(29)17(31)23(39-7-3)19(33)21(13)43-27(37)28(38)44-22-14(26(36)42-12-10-6-2)16(30)18(32)24(20(22)34)40-8-4/h5-12H2,1-4H3 |
| InChIKey | CJTBQRBDAJHSQO-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 737.24 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate?
The IUPAC name of bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate (CID 21493724) is bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate.
What is the SMILES notation for bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate?
The canonical SMILES for bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate is CCCCOC(=O)c1c(Cl)c(Cl)c(OCC)c(Cl)c1OC(=O)C(=O)Oc1c(Cl)c(OCC)c(Cl)c(Cl)c1C(=O)OCCCC.
What is the InChIKey of bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate?
The InChIKey is CJTBQRBDAJHSQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28Cl6O10/c1-5-9-11-41-25(35)13-15(29)17(31)23(39-7-3)19(33)21(13)43-27(37)28(38)44-22-14(26(36)42-12-10-6-2)16(30)18(32)24(20(22)34)40-8-4/h5-12H2,1-4H3.
What are the key properties of bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate?
bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate has a molecular weight of 737.24 g/mol, XLogP of 8.83, 14 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-butoxycarbonyl-3,4,6-trichloro-5-ethoxyphenyl) oxalate is sourced from PubChem (CID 21493724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).