C21H14O8 — CID 21493746
(3,5,12,14-tetraoxo-4,13-dioxatetracyclo[13.3.1.02,9.06,11]nonadeca-1(19),6(11),7,9,15,17-hexaen-19-yl) butanoate (PubChem CID 21493746) has the molecular formula C21H14O8 and a molecular weight of 394.34 g/mol. Its IUPAC name is (3,5,12,14-tetraoxo-4,13-dioxatetracyclo[13.3.1.02,9.06,11]nonadeca-1(19),6(11),7,9,15,17-hexaen-19-yl) butanoate.
| Compound Name | (3,5,12,14-tetraoxo-4,13-dioxatetracyclo[13.3.1.02,9.06,11]nonadeca-1(19),6(11),7,9,15,17-hexaen-19-yl) butanoate |
|---|---|
| PubChem CID | 21493746 |
| Molecular Formula | C21H14O8 |
| Molecular Weight | 394.34 g/mol |
| Exact Mass | 394.07 |
| IUPAC Name | (3,5,12,14-tetraoxo-4,13-dioxatetracyclo[13.3.1.02,9.06,11]nonadeca-1(19),6(11),7,9,15,17-hexaen-19-yl) butanoate |
| SMILES | CCCC(=O)Oc1c2cccc1C1C(=O)OC(=O)c3ccc1cc3C(=O)OC2=O |
| InChI | InChI=1S/C21H14O8/c1-2-4-15(22)27-17-12-5-3-6-13(17)19(24)28-20(25)14-9-10-7-8-11(14)18(23)29-21(26)16(10)12/h3,5-9,16H,2,4H2,1H3 |
| InChIKey | KDBWCZWWOSCHOR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.34 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|