C20H23ClN2O6S — CID 21493847
6-[[2-carboxy-4-[4-(chloromethyl)phenyl]butanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 21493847) has the molecular formula C20H23ClN2O6S and a molecular weight of 454.93 g/mol. Its IUPAC name is 6-[[2-carboxy-4-[4-(chloromethyl)phenyl]butanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | 6-[[2-carboxy-4-[4-(chloromethyl)phenyl]butanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 21493847 |
| Molecular Formula | C20H23ClN2O6S |
| Molecular Weight | 454.93 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 6-[[2-carboxy-4-[4-(chloromethyl)phenyl]butanoyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)SC2C(NC(=O)C(CCc3ccc(CCl)cc3)C(=O)O)C(=O)N2C1C(=O)O |
| InChI | InChI=1S/C20H23ClN2O6S/c1-20(2)14(19(28)29)23-16(25)13(17(23)30-20)22-15(24)12(18(26)27)8-7-10-3-5-11(9-21)6-4-10/h3-6,12-14,17H,7-9H2,1-2H3,(H,22,24)(H,26,27)(H,28,29) |
| InChIKey | ZFZGDSLHYVMFJL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.93 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|