C10H13N5O — CID 21494301
6-piperidin-1-yl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 21494301) has the molecular formula C10H13N5O and a molecular weight of 219.25 g/mol. Its IUPAC name is 6-piperidin-1-yl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-piperidin-1-yl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 21494301 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 6-piperidin-1-yl-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | O=c1[nH]nc2ccc(N3CCCCC3)nn12 |
| InChI | InChI=1S/C10H13N5O/c16-10-12-11-8-4-5-9(13-15(8)10)14-6-2-1-3-7-14/h4-5H,1-3,6-7H2,(H,12,16) |
| InChIKey | UREAITLUYGVTPN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |