C11H17N5O — CID 21494307
6-(hexylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 21494307) has the molecular formula C11H17N5O and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-(hexylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-(hexylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 21494307 |
| Molecular Formula | C11H17N5O |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6-(hexylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | CCCCCCNc1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C11H17N5O/c1-2-3-4-5-8-12-9-6-7-10-13-14-11(17)16(10)15-9/h6-7H,2-5,8H2,1H3,(H,12,15)(H,14,17) |
| InChIKey | QLTAPCIKLSVHQU-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|