C9H13N5O — CID 21494309
6-(butylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one (PubChem CID 21494309) has the molecular formula C9H13N5O and a molecular weight of 207.24 g/mol. Its IUPAC name is 6-(butylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one.
| Compound Name | 6-(butylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
|---|---|
| PubChem CID | 21494309 |
| Molecular Formula | C9H13N5O |
| Molecular Weight | 207.24 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 6-(butylamino)-2H-[1,2,4]triazolo[4,3-b]pyridazin-3-one |
| SMILES | CCCCNc1ccc2n[nH]c(=O)n2n1 |
| InChI | InChI=1S/C9H13N5O/c1-2-3-6-10-7-4-5-8-11-12-9(15)14(8)13-7/h4-5H,2-3,6H2,1H3,(H,10,13)(H,12,15) |
| InChIKey | GUNVNFAQTMAHJT-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|