About 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol
6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol (PubChem CID 21494654) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol.
Molecular Properties
| Compound Name | 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol |
| PubChem CID | 21494654 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol |
| SMILES | CC1(CCCC2CCCC(O)O2)OCCO1 |
| InChI | InChI=1S/C12H22O4/c1-12(14-8-9-15-12)7-3-5-10-4-2-6-11(13)16-10/h10-11,13H,2-9H2,1H3 |
| InChIKey | OQJWOXQZECFRMC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol?
The IUPAC name of 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol (CID 21494654) is 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol.
What is the SMILES notation for 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol?
The canonical SMILES for 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol is CC1(CCCC2CCCC(O)O2)OCCO1.
What is the InChIKey of 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol?
The InChIKey is OQJWOXQZECFRMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-12(14-8-9-15-12)7-3-5-10-4-2-6-11(13)16-10/h10-11,13H,2-9H2,1H3.
What are the key properties of 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol?
6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol has a molecular weight of 230.30 g/mol, XLogP of 1.81, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[3-(2-methyl-1,3-dioxolan-2-yl)propyl]oxan-2-ol is sourced from PubChem (CID 21494654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).