About (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal
(2E)-4-ethyl-3,7-dimethylocta-2,6-dienal (PubChem CID 21494683) has the molecular formula C12H20O
and a molecular weight of 180.29 g/mol. Its IUPAC name is (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal.
Molecular Properties
| Compound Name | (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal |
| PubChem CID | 21494683 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal |
| SMILES | CCC(CC=C(C)C)/C(C)=C/C=O |
| InChI | InChI=1S/C12H20O/c1-5-12(7-6-10(2)3)11(4)8-9-13/h6,8-9,12H,5,7H2,1-4H3/b11-8+ |
| InChIKey | YLXMOCBCKZJIDU-DHZHZOJOSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal?
The IUPAC name of (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal (CID 21494683) is (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal.
What is the SMILES notation for (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal?
The canonical SMILES for (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal is CCC(CC=C(C)C)/C(C)=C/C=O.
What is the InChIKey of (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal?
The InChIKey is YLXMOCBCKZJIDU-DHZHZOJOSA-N. The full InChI is InChI=1S/C12H20O/c1-5-12(7-6-10(2)3)11(4)8-9-13/h6,8-9,12H,5,7H2,1-4H3/b11-8+.
What are the key properties of (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal?
(2E)-4-ethyl-3,7-dimethylocta-2,6-dienal has a molecular weight of 180.29 g/mol, XLogP of 3.51, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-4-ethyl-3,7-dimethylocta-2,6-dienal is sourced from PubChem (CID 21494683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).