About 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride
6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride (PubChem CID 21496112) has the molecular formula C12H9ClN4O
and a molecular weight of 260.68 g/mol. Its IUPAC name is 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride.
Molecular Properties
| Compound Name | 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride |
| PubChem CID | 21496112 |
| Molecular Formula | C12H9ClN4O |
| Molecular Weight | 260.68 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride |
| SMILES | Cl.O=c1ccc2cc(-c3ccncn3)cnc2[nH]1 |
| InChI | InChI=1S/C12H8N4O.ClH/c17-11-2-1-8-5-9(6-14-12(8)16-11)10-3-4-13-7-15-10;/h1-7H,(H,14,16,17);1H |
| InChIKey | PEWQXYDWIUKVDQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.68 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride?
The IUPAC name of 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride (CID 21496112) is 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride.
What is the SMILES notation for 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride?
The canonical SMILES for 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride is Cl.O=c1ccc2cc(-c3ccncn3)cnc2[nH]1.
What is the InChIKey of 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride?
The InChIKey is PEWQXYDWIUKVDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N4O.ClH/c17-11-2-1-8-5-9(6-14-12(8)16-11)10-3-4-13-7-15-10;/h1-7H,(H,14,16,17);1H.
What are the key properties of 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride?
6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride has a molecular weight of 260.68 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-pyrimidin-4-yl-1H-1,8-naphthyridin-2-one;hydrochloride is sourced from PubChem (CID 21496112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).