C16H18N2O4-2 — CID 21497726
1,1'-biphenyl;bis(N-methylcarbamate) (PubChem CID 21497726) has the molecular formula C16H18N2O4-2 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1,1'-biphenyl;bis(N-methylcarbamate).
| Compound Name | 1,1'-biphenyl;bis(N-methylcarbamate) |
|---|---|
| PubChem CID | 21497726 |
| Molecular Formula | C16H18N2O4-2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1,1'-biphenyl;bis(N-methylcarbamate) |
| SMILES | CNC(=O)[O-].CNC(=O)[O-].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.2C2H5NO2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-3-2(4)5/h1-10H;2*3H,1H3,(H,4,5)/p-2 |
| InChIKey | BKMGVNHIPWDFIC-UHFFFAOYSA-L |
| XLogP | 0.45 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |