About 1,1'-biphenyl;bis(N-methylcarbamate)
1,1'-biphenyl;bis(N-methylcarbamate) (PubChem CID 21497726) has the molecular formula C16H18N2O4-2
and a molecular weight of 302.33 g/mol. Its IUPAC name is 1,1'-biphenyl;bis(N-methylcarbamate).
Molecular Properties
| Compound Name | 1,1'-biphenyl;bis(N-methylcarbamate) |
| PubChem CID | 21497726 |
| Molecular Formula | C16H18N2O4-2 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1,1'-biphenyl;bis(N-methylcarbamate) |
| SMILES | CNC(=O)[O-].CNC(=O)[O-].c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.2C2H5NO2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-3-2(4)5/h1-10H;2*3H,1H3,(H,4,5)/p-2 |
| InChIKey | BKMGVNHIPWDFIC-UHFFFAOYSA-L |
| XLogP | 0.45 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,1'-biphenyl;bis(N-methylcarbamate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;bis(N-methylcarbamate)?
The IUPAC name of 1,1'-biphenyl;bis(N-methylcarbamate) (CID 21497726) is 1,1'-biphenyl;bis(N-methylcarbamate).
What is the SMILES notation for 1,1'-biphenyl;bis(N-methylcarbamate)?
The canonical SMILES for 1,1'-biphenyl;bis(N-methylcarbamate) is CNC(=O)[O-].CNC(=O)[O-].c1ccc(-c2ccccc2)cc1.
What is the InChIKey of 1,1'-biphenyl;bis(N-methylcarbamate)?
The InChIKey is BKMGVNHIPWDFIC-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H10.2C2H5NO2/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;2*1-3-2(4)5/h1-10H;2*3H,1H3,(H,4,5)/p-2.
What are the key properties of 1,1'-biphenyl;bis(N-methylcarbamate)?
1,1'-biphenyl;bis(N-methylcarbamate) has a molecular weight of 302.33 g/mol, XLogP of 0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;bis(N-methylcarbamate) is sourced from PubChem (CID 21497726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).